C24H13ClF2N10O12S3 — CID 135730201
7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-2-[3-sulfo-4-[(2,4,6-trihydroxypyrimidin-5-yl)diazenyl]phenyl]benzo[e]benzotriazole-5,9-disulfonic acid (PubChem CID 135730201) has the molecular formula C24H13ClF2N10O12S3 and a molecular weight of 803.08 g/mol. Its IUPAC name is 7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-2-[3-sulfo-4-[(2,4,6-trihydroxypyrimidin-5-yl)diazenyl]phenyl]benzo[e]benzotriazole-5,9-disulfonic acid.
| Compound Name | 7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-2-[3-sulfo-4-[(2,4,6-trihydroxypyrimidin-5-yl)diazenyl]phenyl]benzo[e]benzotriazole-5,9-disulfonic acid |
|---|---|
| PubChem CID | 135730201 |
| Molecular Formula | C24H13ClF2N10O12S3 |
| Molecular Weight | 803.08 g/mol |
| Exact Mass | 801.95 |
| IUPAC Name | 7-[(5-chloro-2,6-difluoropyrimidin-4-yl)amino]-2-[3-sulfo-4-[(2,4,6-trihydroxypyrimidin-5-yl)diazenyl]phenyl]benzo[e]benzotriazole-5,9-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc(-n2nc3cc(S(=O)(=O)O)c4cc(Nc5nc(F)nc(F)c5Cl)cc(S(=O)(=O)O)c4c3n2)ccc1/N=N/c1c(O)nc(O)nc1O |
| InChI | InChI=1S/C24H13ClF2N10O12S3/c25-16-19(26)29-23(27)30-20(16)28-7-3-9-12(50(41,42)43)6-11-17(15(9)14(4-7)52(47,48)49)36-37(35-11)8-1-2-10(13(5-8)51(44,45)46)33-34-18-21(38)31-24(40)32-22(18)39/h1-6H,(H,28,29,30)(H,41,42,43)(H,44,45,46)(H,47,48,49)(H3,31,32,38,39,40)/b34-33+ |
| InChIKey | NHTKZZWGBSYJHI-JEIPZWNWSA-N |
| XLogP | 3.10 |
| TPSA | 342.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|