C15H16N3O2- — CID 135734520
4-[(2E)-2-[1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylidene]hydrazinyl]benzoate (PubChem CID 135734520) has the molecular formula C15H16N3O2- and a molecular weight of 270.31 g/mol. Its IUPAC name is 4-[(2E)-2-[1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2E)-2-[1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 135734520 |
| Molecular Formula | C15H16N3O2- |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-[(2E)-2-[1-(2,4-dimethyl-1H-pyrrol-3-yl)ethylidene]hydrazinyl]benzoate |
| SMILES | C/C(=N\Nc1ccc(C(=O)[O-])cc1)c1c(C)c[nH]c1C |
| InChI | InChI=1S/C15H17N3O2/c1-9-8-16-10(2)14(9)11(3)17-18-13-6-4-12(5-7-13)15(19)20/h4-8,16,18H,1-3H3,(H,19,20)/p-1/b17-11+ |
| InChIKey | XTWOKSBHTXDYPB-GZTJUZNOSA-M |
| XLogP | 1.83 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|