C9H14N2O6 — CID 135753400
methyl 2-diazo-3-hydroxy-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propanoate (PubChem CID 135753400) has the molecular formula C9H14N2O6 and a molecular weight of 246.22 g/mol. Its IUPAC name is methyl 2-diazo-3-hydroxy-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propanoate.
| Compound Name | methyl 2-diazo-3-hydroxy-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propanoate |
|---|---|
| PubChem CID | 135753400 |
| Molecular Formula | C9H14N2O6 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | methyl 2-diazo-3-hydroxy-3-[(2R,4S,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl]propanoate |
| SMILES | COC(=O)C(=[N+]=[N-])C(O)[C@@H]1O[C@H](C)OC[C@H]1O |
| InChI | InChI=1S/C9H14N2O6/c1-4-16-3-5(12)8(17-4)7(13)6(11-10)9(14)15-2/h4-5,7-8,12-13H,3H2,1-2H3/t4-,5-,7?,8-/m1/s1 |
| InChIKey | KMVKKFHSJWFQJJ-QXWBCITLSA-N |
| XLogP | -1.69 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|