C6H5N5O3 — CID 135755304
2-amino-5,8-dihydro-4aH-pteridine-4,6,7-trione (PubChem CID 135755304) has the molecular formula C6H5N5O3 and a molecular weight of 195.14 g/mol. Its IUPAC name is 2-amino-5,8-dihydro-4aH-pteridine-4,6,7-trione.
| Compound Name | 2-amino-5,8-dihydro-4aH-pteridine-4,6,7-trione |
|---|---|
| PubChem CID | 135755304 |
| Molecular Formula | C6H5N5O3 |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-amino-5,8-dihydro-4aH-pteridine-4,6,7-trione |
| SMILES | NC1=NC(=O)C2NC(=O)C(=O)NC2=N1 |
| InChI | InChI=1S/C6H5N5O3/c7-6-10-2-1(3(12)11-6)8-4(13)5(14)9-2/h1H,(H,8,13)(H3,7,9,10,11,12,14) |
| InChIKey | FLJBMWVIRUUAFV-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|