C7H6N4O4 — CID 23422170
3-methyl-5,8-dihydro-4aH-pteridine-2,4,6,7-tetrone (PubChem CID 23422170) has the molecular formula C7H6N4O4 and a molecular weight of 210.15 g/mol. Its IUPAC name is 3-methyl-5,8-dihydro-4aH-pteridine-2,4,6,7-tetrone.
| Compound Name | 3-methyl-5,8-dihydro-4aH-pteridine-2,4,6,7-tetrone |
|---|---|
| PubChem CID | 23422170 |
| Molecular Formula | C7H6N4O4 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 3-methyl-5,8-dihydro-4aH-pteridine-2,4,6,7-tetrone |
| SMILES | CN1C(=O)N=C2NC(=O)C(=O)NC2C1=O |
| InChI | InChI=1S/C7H6N4O4/c1-11-6(14)2-3(10-7(11)15)9-5(13)4(12)8-2/h2H,1H3,(H,8,12)(H,9,10,13,15) |
| InChIKey | QMRAOUHRRGUKGD-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|