C7H6N4O3 — CID 91731837
7-methyl-4a,5-dihydropteridine-2,4,6-trione (PubChem CID 91731837) has the molecular formula C7H6N4O3 and a molecular weight of 194.15 g/mol. Its IUPAC name is 7-methyl-4a,5-dihydropteridine-2,4,6-trione.
| Compound Name | 7-methyl-4a,5-dihydropteridine-2,4,6-trione |
|---|---|
| PubChem CID | 91731837 |
| Molecular Formula | C7H6N4O3 |
| Molecular Weight | 194.15 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | 7-methyl-4a,5-dihydropteridine-2,4,6-trione |
| SMILES | CC1=NC2=NC(=O)NC(=O)C2NC1=O |
| InChI | InChI=1S/C7H6N4O3/c1-2-5(12)9-3-4(8-2)10-7(14)11-6(3)13/h3H,1H3,(H,9,12)(H,11,13,14) |
| InChIKey | PZGXNGZKGYATDW-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.15 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |