C7H8N4O3 — CID 22294407
7-methyl-1,4a,5,8a-tetrahydropteridine-2,4,6-trione (PubChem CID 22294407) has the molecular formula C7H8N4O3 and a molecular weight of 196.17 g/mol. Its IUPAC name is 7-methyl-1,4a,5,8a-tetrahydropteridine-2,4,6-trione.
| Compound Name | 7-methyl-1,4a,5,8a-tetrahydropteridine-2,4,6-trione |
|---|---|
| PubChem CID | 22294407 |
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 7-methyl-1,4a,5,8a-tetrahydropteridine-2,4,6-trione |
| SMILES | CC1=NC2NC(=O)NC(=O)C2NC1=O |
| InChI | InChI=1S/C7H8N4O3/c1-2-5(12)9-3-4(8-2)10-7(14)11-6(3)13/h3-4H,1H3,(H,9,12)(H2,10,11,13,14) |
| InChIKey | KGQFLBGORBZGCE-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |