C5H9N5O2 — CID 56616942
N-(2,4-diamino-6-oxo-2,5-dihydro-1H-pyrimidin-5-yl)formamide (PubChem CID 56616942) has the molecular formula C5H9N5O2 and a molecular weight of 171.16 g/mol. Its IUPAC name is N-(2,4-diamino-6-oxo-2,5-dihydro-1H-pyrimidin-5-yl)formamide.
| Compound Name | N-(2,4-diamino-6-oxo-2,5-dihydro-1H-pyrimidin-5-yl)formamide |
|---|---|
| PubChem CID | 56616942 |
| Molecular Formula | C5H9N5O2 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | N-(2,4-diamino-6-oxo-2,5-dihydro-1H-pyrimidin-5-yl)formamide |
| SMILES | NC1=NC(N)NC(=O)C1NC=O |
| InChI | InChI=1S/C5H9N5O2/c6-3-2(8-1-11)4(12)10-5(7)9-3/h1-2,5H,7H2,(H2,6,9)(H,8,11)(H,10,12) |
| InChIKey | CXYJQMMDNHZOBO-UHFFFAOYSA-N |
| XLogP | -3.17 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|