C18H13N5O3 — CID 135766941
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(3-nitrophenyl)methylideneamino]but-2-enenitrile (PubChem CID 135766941) has the molecular formula C18H13N5O3 and a molecular weight of 347.33 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(3-nitrophenyl)methylideneamino]but-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(3-nitrophenyl)methylideneamino]but-2-enenitrile |
|---|---|
| PubChem CID | 135766941 |
| Molecular Formula | C18H13N5O3 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(3-nitrophenyl)methylideneamino]but-2-enenitrile |
| SMILES | N#C/C(=C(/O)C/N=C/c1cccc([N+](=O)[O-])c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H13N5O3/c19-9-14(18-21-15-6-1-2-7-16(15)22-18)17(24)11-20-10-12-4-3-5-13(8-12)23(25)26/h1-8,10,24H,11H2,(H,21,22)/b17-14-,20-10+ |
| InChIKey | ABHKBLDYTBAPSH-AZNFOZBCSA-N |
| XLogP | 3.38 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|