C23H24ClN3O2S — CID 135768768
ethyl 5-(2-chlorophenyl)-2-(prop-2-ynylamino)-2,3,6,7,8,9-hexahydro-1H-[1]benzothiolo[2,3-e][1,4]diazepine-7-carboxylate (PubChem CID 135768768) has the molecular formula C23H24ClN3O2S and a molecular weight of 441.98 g/mol. Its IUPAC name is ethyl 5-(2-chlorophenyl)-2-(prop-2-ynylamino)-2,3,6,7,8,9-hexahydro-1H-[1]benzothiolo[2,3-e][1,4]diazepine-7-carboxylate.
| Compound Name | ethyl 5-(2-chlorophenyl)-2-(prop-2-ynylamino)-2,3,6,7,8,9-hexahydro-1H-[1]benzothiolo[2,3-e][1,4]diazepine-7-carboxylate |
|---|---|
| PubChem CID | 135768768 |
| Molecular Formula | C23H24ClN3O2S |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | ethyl 5-(2-chlorophenyl)-2-(prop-2-ynylamino)-2,3,6,7,8,9-hexahydro-1H-[1]benzothiolo[2,3-e][1,4]diazepine-7-carboxylate |
| SMILES | C#CCNC1CN=C(c2ccccc2Cl)c2c(sc3c2CC(C(=O)OCC)CC3)N1 |
| InChI | InChI=1S/C23H24ClN3O2S/c1-3-11-25-19-13-26-21(15-7-5-6-8-17(15)24)20-16-12-14(23(28)29-4-2)9-10-18(16)30-22(20)27-19/h1,5-8,14,19,25,27H,4,9-13H2,2H3 |
| InChIKey | OGWWHULDMCTPHA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|