C13H19Cl2N5O — CID 135770307
(2E)-N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-hydrazinylidene-N-hydroxypropanimidamide (PubChem CID 135770307) has the molecular formula C13H19Cl2N5O and a molecular weight of 332.24 g/mol. Its IUPAC name is (2E)-N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-hydrazinylidene-N-hydroxypropanimidamide.
| Compound Name | (2E)-N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-hydrazinylidene-N-hydroxypropanimidamide |
|---|---|
| PubChem CID | 135770307 |
| Molecular Formula | C13H19Cl2N5O |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (2E)-N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-hydrazinylidene-N-hydroxypropanimidamide |
| SMILES | CC(=N\N)/C(=N/c1ccc(N(CCCl)CCCl)cc1)NO |
| InChI | InChI=1S/C13H19Cl2N5O/c1-10(18-16)13(19-21)17-11-2-4-12(5-3-11)20(8-6-14)9-7-15/h2-5,21H,6-9,16H2,1H3,(H,17,19)/b18-10+ |
| InChIKey | XPPHSIUSSBOFCY-VCHYOVAHSA-N |
| XLogP | 2.31 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|