C18H21Cl2N5O2 — CID 168664830
N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-(furan-2-ylmethylidenehydrazinylidene)-N-hydroxypropanimidamide (PubChem CID 168664830) has the molecular formula C18H21Cl2N5O2 and a molecular weight of 410.31 g/mol. Its IUPAC name is N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-(furan-2-ylmethylidenehydrazinylidene)-N-hydroxypropanimidamide.
| Compound Name | N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-(furan-2-ylmethylidenehydrazinylidene)-N-hydroxypropanimidamide |
|---|---|
| PubChem CID | 168664830 |
| Molecular Formula | C18H21Cl2N5O2 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N'-[4-[bis(2-chloroethyl)amino]phenyl]-2-(furan-2-ylmethylidenehydrazinylidene)-N-hydroxypropanimidamide |
| SMILES | CC(=NN=Cc1ccco1)/C(=N/c1ccc(N(CCCl)CCCl)cc1)NO |
| InChI | InChI=1S/C18H21Cl2N5O2/c1-14(23-21-13-17-3-2-12-27-17)18(24-26)22-15-4-6-16(7-5-15)25(10-8-19)11-9-20/h2-7,12-13,26H,8-11H2,1H3,(H,22,24) |
| InChIKey | MGRKHDOBPJUTPJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|