C23H22N2O4 — CID 135777499
3-[(Z)-2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-2-oxo-1H-quinoxaline-6-carboxylic acid (PubChem CID 135777499) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-[(Z)-2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-2-oxo-1H-quinoxaline-6-carboxylic acid.
| Compound Name | 3-[(Z)-2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-2-oxo-1H-quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 135777499 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3-[(Z)-2-(4-cyclohexylphenyl)-2-hydroxyethenyl]-2-oxo-1H-quinoxaline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]c(=O)c(/C=C(\O)c3ccc(C4CCCCC4)cc3)nc2c1 |
| InChI | InChI=1S/C23H22N2O4/c26-21(16-8-6-15(7-9-16)14-4-2-1-3-5-14)13-20-22(27)25-18-11-10-17(23(28)29)12-19(18)24-20/h6-14,26H,1-5H2,(H,25,27)(H,28,29)/b21-13- |
| InChIKey | OLEDRGGUIRKUCB-BKUYFWCQSA-N |
| XLogP | 4.73 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|