C18H21N5O2 — CID 135778497
11-benzyl-9-butyl-3,6,7,9,11-pentazatricyclo[6.4.0.02,6]dodeca-1,7-diene-10,12-dione (PubChem CID 135778497) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 11-benzyl-9-butyl-3,6,7,9,11-pentazatricyclo[6.4.0.02,6]dodeca-1,7-diene-10,12-dione.
| Compound Name | 11-benzyl-9-butyl-3,6,7,9,11-pentazatricyclo[6.4.0.02,6]dodeca-1,7-diene-10,12-dione |
|---|---|
| PubChem CID | 135778497 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 11-benzyl-9-butyl-3,6,7,9,11-pentazatricyclo[6.4.0.02,6]dodeca-1,7-diene-10,12-dione |
| SMILES | CCCCn1c(=O)n(Cc2ccccc2)c(=O)c2c3n(nc21)CCN3 |
| InChI | InChI=1S/C18H21N5O2/c1-2-3-10-21-16-14(15-19-9-11-23(15)20-16)17(24)22(18(21)25)12-13-7-5-4-6-8-13/h4-8,19H,2-3,9-12H2,1H3 |
| InChIKey | SRIFYUCQLXEMPP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |