C14H13N5O — CID 135749799
4-benzyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one (PubChem CID 135749799) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-benzyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one.
| Compound Name | 4-benzyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one |
|---|---|
| PubChem CID | 135749799 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 4-benzyl-8,9-dihydro-7H-imidazo[2,1-f]purin-5-one |
| SMILES | O=c1n(Cc2ccccc2)c2ncnc-2c2n1CCN2 |
| InChI | InChI=1S/C14H13N5O/c20-14-18-7-6-15-12(18)11-13(17-9-16-11)19(14)8-10-4-2-1-3-5-10/h1-5,9,15H,6-8H2 |
| InChIKey | JXMNGJYBTCMZPA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |