C30H23N5O2S — CID 135782338
(2E,5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135782338) has the molecular formula C30H23N5O2S and a molecular weight of 517.61 g/mol. Its IUPAC name is (2E,5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135782338 |
| Molecular Formula | C30H23N5O2S |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (2E,5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-2-[(E)-furan-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\N=C\c2ccco2)S/C1=C/c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H23N5O2S/c36-29-28(38-30(32-29)33-31-20-25-12-7-17-37-25)18-21-13-15-24(16-14-21)35-27(23-10-5-2-6-11-23)19-26(34-35)22-8-3-1-4-9-22/h1-18,20,27H,19H2,(H,32,33,36)/b28-18+,31-20+ |
| InChIKey | UDQIWDLWHRFOKX-NPMFAPPMSA-N |
| XLogP | 6.23 |
| TPSA | 82.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|