C25H21N3OS2 — CID 142938800
(5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-4-hydroxy-1,3-thiazolidine-2-thione (PubChem CID 142938800) has the molecular formula C25H21N3OS2 and a molecular weight of 443.60 g/mol. Its IUPAC name is (5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-4-hydroxy-1,3-thiazolidine-2-thione.
| Compound Name | (5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-4-hydroxy-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 142938800 |
| Molecular Formula | C25H21N3OS2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (5E)-5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-4-hydroxy-1,3-thiazolidine-2-thione |
| SMILES | OC1NC(=S)S/C1=C/c1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3OS2/c29-24-23(31-25(30)26-24)15-17-11-13-20(14-12-17)28-22(19-9-5-2-6-10-19)16-21(27-28)18-7-3-1-4-8-18/h1-15,22,24,29H,16H2,(H,26,30)/b23-15+ |
| InChIKey | CYJHVTXFPUQGSY-HZHRSRAPSA-N |
| XLogP | 5.32 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|