C33H27N3O2S2 — CID 3445047
5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-3-(4-ethoxyphenyl)-4-sulfanylidene-1,3-thiazolidin-2-one (PubChem CID 3445047) has the molecular formula C33H27N3O2S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is 5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-3-(4-ethoxyphenyl)-4-sulfanylidene-1,3-thiazolidin-2-one.
| Compound Name | 5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-3-(4-ethoxyphenyl)-4-sulfanylidene-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 3445047 |
| Molecular Formula | C33H27N3O2S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 5-[[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]-3-(4-ethoxyphenyl)-4-sulfanylidene-1,3-thiazolidin-2-one |
| SMILES | CCOc1ccc(N2C(=O)SC(=Cc3ccc(N4N=C(c5ccccc5)CC4c4ccccc4)cc3)C2=S)cc1 |
| InChI | InChI=1S/C33H27N3O2S2/c1-2-38-28-19-17-26(18-20-28)35-32(39)31(40-33(35)37)21-23-13-15-27(16-14-23)36-30(25-11-7-4-8-12-25)22-29(34-36)24-9-5-3-6-10-24/h3-21,30H,2,22H2,1H3 |
| InChIKey | CBPJXLMRUALTHR-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|