C16H21N3OS — CID 135786537
5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-triazole-3-thione (PubChem CID 135786537) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 135786537 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)-1,2,4-triazole-3-thione |
| SMILES | CC(C)(C)c1cc(C2=NC(=S)N=N2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C16H21N3OS/c1-15(2,3)10-7-9(13-17-14(21)19-18-13)8-11(12(10)20)16(4,5)6/h7-8,20H,1-6H3 |
| InChIKey | MTEPBLJNGUNHFU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|