C25H30N2O2 — CID 135787784
1-[(2-hydroxy-5-methylphenyl)diazenyl]-6-(2,4,4-trimethylpentan-2-yl)naphthalen-2-ol (PubChem CID 135787784) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[(2-hydroxy-5-methylphenyl)diazenyl]-6-(2,4,4-trimethylpentan-2-yl)naphthalen-2-ol.
| Compound Name | 1-[(2-hydroxy-5-methylphenyl)diazenyl]-6-(2,4,4-trimethylpentan-2-yl)naphthalen-2-ol |
|---|---|
| PubChem CID | 135787784 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-[(2-hydroxy-5-methylphenyl)diazenyl]-6-(2,4,4-trimethylpentan-2-yl)naphthalen-2-ol |
| SMILES | Cc1ccc(O)c(/N=N/c2c(O)ccc3cc(C(C)(C)CC(C)(C)C)ccc23)c1 |
| InChI | InChI=1S/C25H30N2O2/c1-16-7-11-21(28)20(13-16)26-27-23-19-10-9-18(14-17(19)8-12-22(23)29)25(5,6)15-24(2,3)4/h7-14,28-29H,15H2,1-6H3/b27-26+ |
| InChIKey | CAVZSRFTIFXEJH-CYYJNZCTSA-N |
| XLogP | 7.69 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|