C12H10F3N5O2 — CID 135822263
1-hydroxy-2-[(E)-[4-oxo-7-(trifluoromethyl)-1H-quinolin-3-yl]methylideneamino]guanidine (PubChem CID 135822263) has the molecular formula C12H10F3N5O2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-[4-oxo-7-(trifluoromethyl)-1H-quinolin-3-yl]methylideneamino]guanidine.
| Compound Name | 1-hydroxy-2-[(E)-[4-oxo-7-(trifluoromethyl)-1H-quinolin-3-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 135822263 |
| Molecular Formula | C12H10F3N5O2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-hydroxy-2-[(E)-[4-oxo-7-(trifluoromethyl)-1H-quinolin-3-yl]methylideneamino]guanidine |
| SMILES | NC(=N/N=C/c1c[nH]c2cc(C(F)(F)F)ccc2c1=O)NO |
| InChI | InChI=1S/C12H10F3N5O2/c13-12(14,15)7-1-2-8-9(3-7)17-4-6(10(8)21)5-18-19-11(16)20-22/h1-5,22H,(H,17,21)(H3,16,19,20)/b18-5+ |
| InChIKey | XISOYJXDSIPIEK-BLLMUTORSA-N |
| XLogP | 1.17 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|