C33H35N3O5 — CID 135829598
[4-[4-(2-hexoxyethoxy)-2-hydroxyphenyl]-6-(4-methylbenzoyl)-1,3,5-triazin-2-yl]-(4-methylphenyl)methanone (PubChem CID 135829598) has the molecular formula C33H35N3O5 and a molecular weight of 553.66 g/mol. Its IUPAC name is [4-[4-(2-hexoxyethoxy)-2-hydroxyphenyl]-6-(4-methylbenzoyl)-1,3,5-triazin-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-[4-(2-hexoxyethoxy)-2-hydroxyphenyl]-6-(4-methylbenzoyl)-1,3,5-triazin-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 135829598 |
| Molecular Formula | C33H35N3O5 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | [4-[4-(2-hexoxyethoxy)-2-hydroxyphenyl]-6-(4-methylbenzoyl)-1,3,5-triazin-2-yl]-(4-methylphenyl)methanone |
| SMILES | CCCCCCOCCOc1ccc(-c2nc(C(=O)c3ccc(C)cc3)nc(C(=O)c3ccc(C)cc3)n2)c(O)c1 |
| InChI | InChI=1S/C33H35N3O5/c1-4-5-6-7-18-40-19-20-41-26-16-17-27(28(37)21-26)31-34-32(29(38)24-12-8-22(2)9-13-24)36-33(35-31)30(39)25-14-10-23(3)11-15-25/h8-17,21,37H,4-7,18-20H2,1-3H3 |
| InChIKey | DAQBRXAPEQGECW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|