C22H27ClOS2 — CID 135840344
(4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate (PubChem CID 135840344) has the molecular formula C22H27ClOS2 and a molecular weight of 407.04 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate.
| Compound Name | (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate |
|---|---|
| PubChem CID | 135840344 |
| Molecular Formula | C22H27ClOS2 |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate |
| SMILES | CC(C)(C)c1cc(C(=S)SCc2ccc(Cl)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H27ClOS2/c1-21(2,3)17-11-15(12-18(19(17)24)22(4,5)6)20(25)26-13-14-7-9-16(23)10-8-14/h7-12,24H,13H2,1-6H3 |
| InChIKey | YGLNXJSKQGIYLL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|