About (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate
(4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate (PubChem CID 135840344) has the molecular formula C22H27ClOS2
and a molecular weight of 407.04 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate.
Molecular Properties
| Compound Name | (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate |
| PubChem CID | 135840344 |
| Molecular Formula | C22H27ClOS2 |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate |
| SMILES | CC(C)(C)c1cc(C(=S)SCc2ccc(Cl)cc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H27ClOS2/c1-21(2,3)17-11-15(12-18(19(17)24)22(4,5)6)20(25)26-13-14-7-9-16(23)10-8-14/h7-12,24H,13H2,1-6H3 |
| InChIKey | YGLNXJSKQGIYLL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate?
The IUPAC name of (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate (CID 135840344) is (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate.
What is the SMILES notation for (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate?
The canonical SMILES for (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate is CC(C)(C)c1cc(C(=S)SCc2ccc(Cl)cc2)cc(C(C)(C)C)c1O.
What is the InChIKey of (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate?
The InChIKey is YGLNXJSKQGIYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClOS2/c1-21(2,3)17-11-15(12-18(19(17)24)22(4,5)6)20(25)26-13-14-7-9-16(23)10-8-14/h7-12,24H,13H2,1-6H3.
What are the key properties of (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate?
(4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate has a molecular weight of 407.04 g/mol, XLogP of 7.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 3,5-ditert-butyl-4-hydroxybenzenecarbodithioate is sourced from PubChem (CID 135840344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).