C24H24N2OS — CID 135843625
(5R)-2-benzylsulfanyl-5-cyclopentyl-5,6-dihydro-3H-benzo[h]quinazolin-4-one (PubChem CID 135843625) has the molecular formula C24H24N2OS and a molecular weight of 388.54 g/mol. Its IUPAC name is (5R)-2-benzylsulfanyl-5-cyclopentyl-5,6-dihydro-3H-benzo[h]quinazolin-4-one.
| Compound Name | (5R)-2-benzylsulfanyl-5-cyclopentyl-5,6-dihydro-3H-benzo[h]quinazolin-4-one |
|---|---|
| PubChem CID | 135843625 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (5R)-2-benzylsulfanyl-5-cyclopentyl-5,6-dihydro-3H-benzo[h]quinazolin-4-one |
| SMILES | O=c1[nH]c(SCc2ccccc2)nc2c1[C@@H](C1CCCC1)Cc1ccccc1-2 |
| InChI | InChI=1S/C24H24N2OS/c27-23-21-20(17-10-4-5-11-17)14-18-12-6-7-13-19(18)22(21)25-24(26-23)28-15-16-8-2-1-3-9-16/h1-3,6-9,12-13,17,20H,4-5,10-11,14-15H2,(H,25,26,27)/t20-/m1/s1 |
| InChIKey | IUPDUFSFKOSRSW-HXUWFJFHSA-N |
| XLogP | 5.56 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |