C31H28N4O — CID 135846004
(1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]ethanol (PubChem CID 135846004) has the molecular formula C31H28N4O and a molecular weight of 472.59 g/mol. Its IUPAC name is (1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]ethanol.
| Compound Name | (1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]ethanol |
|---|---|
| PubChem CID | 135846004 |
| Molecular Formula | C31H28N4O |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (1Z)-1-[13,13-dimethyl-5-(4-methylphenyl)-12,23-dihydroporphyrin-2-ylidene]ethanol |
| SMILES | C/C(O)=C1\C=C2N=C1/C=C1/C=CC(=N1)/C=C1\N/C(=C\C3=N/C(=C\2c2ccc(C)cc2)C=C3)CC1(C)C |
| InChI | InChI=1S/C31H28N4O/c1-18-5-7-20(8-6-18)30-26-12-11-21(33-26)13-24-17-31(3,4)29(34-24)15-23-10-9-22(32-23)14-27-25(19(2)36)16-28(30)35-27/h5-16,34,36H,17H2,1-4H3/b22-14-,24-13-,25-19-,29-15-,30-26- |
| InChIKey | BPNALQSBNZHXNA-YXMIUUOHSA-N |
| XLogP | 6.58 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|