C24H24N4O3 — CID 135846555
ethyl 2-[2-hydroxy-3-[(4,7,8-trimethylquinolin-2-yl)diazenyl]indol-1-yl]acetate (PubChem CID 135846555) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is ethyl 2-[2-hydroxy-3-[(4,7,8-trimethylquinolin-2-yl)diazenyl]indol-1-yl]acetate.
| Compound Name | ethyl 2-[2-hydroxy-3-[(4,7,8-trimethylquinolin-2-yl)diazenyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 135846555 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | ethyl 2-[2-hydroxy-3-[(4,7,8-trimethylquinolin-2-yl)diazenyl]indol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1c(O)c(/N=N/c2cc(C)c3ccc(C)c(C)c3n2)c2ccccc21 |
| InChI | InChI=1S/C24H24N4O3/c1-5-31-21(29)13-28-19-9-7-6-8-18(19)23(24(28)30)27-26-20-12-15(3)17-11-10-14(2)16(4)22(17)25-20/h6-12,30H,5,13H2,1-4H3/b27-26+ |
| InChIKey | REKMDZUYNAPZNH-CYYJNZCTSA-N |
| XLogP | 5.80 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|