C24H22N4O4Zn — CID 135870278
zinc bis(3-(1H-indol-3-ylmethylideneamino)propanoate) (PubChem CID 135870278) has the molecular formula C24H22N4O4Zn and a molecular weight of 495.85 g/mol. Its IUPAC name is zinc bis(3-(1H-indol-3-ylmethylideneamino)propanoate).
| Compound Name | zinc bis(3-(1H-indol-3-ylmethylideneamino)propanoate) |
|---|---|
| PubChem CID | 135870278 |
| Molecular Formula | C24H22N4O4Zn |
| Molecular Weight | 495.85 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | zinc bis(3-(1H-indol-3-ylmethylideneamino)propanoate) |
| SMILES | O=C([O-])CC/N=C/c1c[nH]c2ccccc12.O=C([O-])CC/N=C/c1c[nH]c2ccccc12.[Zn+2] |
| InChI | InChI=1S/2C12H12N2O2.Zn/c2*15-12(16)5-6-13-7-9-8-14-11-4-2-1-3-10(9)11;/h2*1-4,7-8,14H,5-6H2,(H,15,16);/q;;+2/p-2/b2*13-7+; |
| InChIKey | YAZDUCLUBJSGNO-CJYSFSJTSA-L |
| XLogP | 1.45 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.85 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|