C16H10O6 — CID 135873704
4,15-dihydroxy-11-methoxy-8,14-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaen-5-one (PubChem CID 135873704) has the molecular formula C16H10O6 and a molecular weight of 298.25 g/mol. Its IUPAC name is 4,15-dihydroxy-11-methoxy-8,14-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaen-5-one.
| Compound Name | 4,15-dihydroxy-11-methoxy-8,14-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaen-5-one |
|---|---|
| PubChem CID | 135873704 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 4,15-dihydroxy-11-methoxy-8,14-dioxatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,6,9(17),10,12,15-heptaen-5-one |
| SMILES | COc1cc2oc(O)cc3c4cc(O)c(=O)cc4oc(c1)c23 |
| InChI | InChI=1S/C16H10O6/c1-20-7-2-13-16-9(5-15(19)22-14(16)3-7)8-4-10(17)11(18)6-12(8)21-13/h2-6,17,19H,1H3 |
| InChIKey | FAVAWTOATHDWMK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|