C19H21BrN4OS — CID 135888491
4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-piperidin-1-yl-2H-pyrrol-3-ol (PubChem CID 135888491) has the molecular formula C19H21BrN4OS and a molecular weight of 433.38 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-piperidin-1-yl-2H-pyrrol-3-ol.
| Compound Name | 4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-piperidin-1-yl-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135888491 |
| Molecular Formula | C19H21BrN4OS |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 4-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-5-imino-1-piperidin-1-yl-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc(-c3ccc(Br)cc3)c(C)s2)=C(O)CN1N1CCCCC1 |
| InChI | InChI=1S/C19H21BrN4OS/c1-12-17(13-5-7-14(20)8-6-13)22-19(26-12)16-15(25)11-24(18(16)21)23-9-3-2-4-10-23/h5-8,21,25H,2-4,9-11H2,1H3/b21-18- |
| InChIKey | AHVLGWQGNDLDGU-UZYVYHOESA-N |
| XLogP | 4.84 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|