C11H13ClFN7O4S — CID 135895372
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135895372) has the molecular formula C11H13ClFN7O4S and a molecular weight of 393.79 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135895372 |
| Molecular Formula | C11H13ClFN7O4S |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCCNc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C11H13ClFN7O4S/c12-7-5-6(1-2-8(7)13)17-11(18-21)9-10(20-24-19-9)15-3-4-16-25(14,22)23/h1-2,5,16,21H,3-4H2,(H,15,20)(H,17,18)(H2,14,22,23) |
| InChIKey | WZVAULHJNFGOBR-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 167.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|