C21H22ClN5O4 — CID 135903434
(13R)-13-(3-chloro-5-ethoxy-4-methoxyphenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine (PubChem CID 135903434) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is (13R)-13-(3-chloro-5-ethoxy-4-methoxyphenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine.
| Compound Name | (13R)-13-(3-chloro-5-ethoxy-4-methoxyphenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
|---|---|
| PubChem CID | 135903434 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (13R)-13-(3-chloro-5-ethoxy-4-methoxyphenyl)-4,8-dioxa-12,14,16,18-tetrazatetracyclo[9.7.0.03,9.012,17]octadeca-1,3(9),10,14,17-pentaen-15-amine |
| SMILES | CCOc1cc([C@@H]2N=C(N)Nc3nc4cc5c(cc4n32)OCCCO5)cc(Cl)c1OC |
| InChI | InChI=1S/C21H22ClN5O4/c1-3-29-17-8-11(7-12(22)18(17)28-2)19-25-20(23)26-21-24-13-9-15-16(10-14(13)27(19)21)31-6-4-5-30-15/h7-10,19H,3-6H2,1-2H3,(H3,23,24,25,26)/t19-/m1/s1 |
| InChIKey | AHDRERXLKHNKHB-LJQANCHMSA-N |
| XLogP | 3.55 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |