About 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride
4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride (PubChem CID 135939250) has the molecular formula C7H11ClN2S
and a molecular weight of 190.70 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride.
Analyze 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride?
The IUPAC name of 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride (CID 135939250) is 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride.
What is the SMILES notation for 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride?
The canonical SMILES for 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride is Nc1[nH+]c2c(s1)CCCC2.[Cl-].
What is the InChIKey of 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride?
The InChIKey is CLQLOFQYFKYTJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S.ClH/c8-7-9-5-3-1-2-4-6(5)10-7;/h1-4H2,(H2,8,9);1H.
What are the key properties of 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride?
4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride has a molecular weight of 190.70 g/mol, XLogP of -1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-1,3-benzothiazol-3-ium-2-amine chloride is sourced from PubChem (CID 135939250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).