C20H25N5O2 — CID 135972573
2-(2-hydroxyphenyl)-7-methylidene-N-octylimidazo[1,5-b][1,2,4]triazole-5-carboxamide (PubChem CID 135972573) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-7-methylidene-N-octylimidazo[1,5-b][1,2,4]triazole-5-carboxamide.
| Compound Name | 2-(2-hydroxyphenyl)-7-methylidene-N-octylimidazo[1,5-b][1,2,4]triazole-5-carboxamide |
|---|---|
| PubChem CID | 135972573 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2-(2-hydroxyphenyl)-7-methylidene-N-octylimidazo[1,5-b][1,2,4]triazole-5-carboxamide |
| SMILES | C=c1nc(C(=O)NCCCCCCCC)n2nc(-c3ccccc3O)nc12 |
| InChI | InChI=1S/C20H25N5O2/c1-3-4-5-6-7-10-13-21-20(27)19-22-14(2)18-23-17(24-25(18)19)15-11-8-9-12-16(15)26/h8-9,11-12,26H,2-7,10,13H2,1H3,(H,21,27) |
| InChIKey | WIKISUQDPMAWGF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|