C13H15ClN6O — CID 135973224
2,4-diamino-5-[(4-chloro-5-ethyl-2-methylphenyl)diazenyl]-1H-pyrimidin-6-one (PubChem CID 135973224) has the molecular formula C13H15ClN6O and a molecular weight of 306.76 g/mol. Its IUPAC name is 2,4-diamino-5-[(4-chloro-5-ethyl-2-methylphenyl)diazenyl]-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-[(4-chloro-5-ethyl-2-methylphenyl)diazenyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135973224 |
| Molecular Formula | C13H15ClN6O |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2,4-diamino-5-[(4-chloro-5-ethyl-2-methylphenyl)diazenyl]-1H-pyrimidin-6-one |
| SMILES | CCc1cc(/N=N/c2c(N)nc(N)[nH]c2=O)c(C)cc1Cl |
| InChI | InChI=1S/C13H15ClN6O/c1-3-7-5-9(6(2)4-8(7)14)19-20-10-11(15)17-13(16)18-12(10)21/h4-5H,3H2,1-2H3,(H5,15,16,17,18,21)/b20-19+ |
| InChIKey | RHHKIPUIGXSREM-FMQUCBEESA-N |
| XLogP | 2.87 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|