C35H23IrN3O-2 — CID 135975731
iridium;2-(1,10-phenanthrolin-2-yl)phenol;2-(3-phenylbenzene-2-id-1-yl)pyridine (PubChem CID 135975731) has the molecular formula C35H23IrN3O-2 and a molecular weight of 693.81 g/mol. Its IUPAC name is iridium;2-(1,10-phenanthrolin-2-yl)phenol;2-(3-phenylbenzene-2-id-1-yl)pyridine.
| Compound Name | iridium;2-(1,10-phenanthrolin-2-yl)phenol;2-(3-phenylbenzene-2-id-1-yl)pyridine |
|---|---|
| PubChem CID | 135975731 |
| Molecular Formula | C35H23IrN3O-2 |
| Molecular Weight | 693.81 g/mol |
| Exact Mass | 694.15 |
| IUPAC Name | iridium;2-(1,10-phenanthrolin-2-yl)phenol;2-(3-phenylbenzene-2-id-1-yl)pyridine |
| SMILES | Oc1ccccc1-c1ccc2ccc3cccnc3c2n1.[Ir].[c-]1ccccc1-c1[c-]c(-c2ccccn2)ccc1 |
| InChI | InChI=1S/C18H12N2O.C17H11N.Ir/c21-16-6-2-1-5-14(16)15-10-9-13-8-7-12-4-3-11-19-17(12)18(13)20-15;1-2-7-14(8-3-1)15-9-6-10-16(13-15)17-11-4-5-12-18-17;/h1-11,21H;1-7,9-12H;/q;-2; |
| InChIKey | UCRMMRPSUFSJRV-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.81 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|