C19H25N5O8S3 — CID 135996528
4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-sulfonamide (PubChem CID 135996528) has the molecular formula C19H25N5O8S3 and a molecular weight of 547.64 g/mol. Its IUPAC name is 4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-sulfonamide.
| Compound Name | 4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 135996528 |
| Molecular Formula | C19H25N5O8S3 |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | 4-[3-(dimethylsulfamoyl)-2-hydroxyanilino]-3-[(1R)-1-(5-methylfuran-2-yl)propyl]imino-1,1-dioxo-1,2-thiazole-5-sulfonamide |
| SMILES | CC[C@@H](/N=C1\NS(=O)(=O)C(S(N)(=O)=O)=C1Nc1cccc(S(=O)(=O)N(C)C)c1O)c1ccc(C)o1 |
| InChI | InChI=1S/C19H25N5O8S3/c1-5-12(14-10-9-11(2)32-14)22-18-16(19(33(20,26)27)34(28,29)23-18)21-13-7-6-8-15(17(13)25)35(30,31)24(3)4/h6-10,12,21,25H,5H2,1-4H3,(H,22,23)(H2,20,26,27)/t12-/m1/s1 |
| InChIKey | GUODTBZIAYUJAY-GFCCVEGCSA-N |
| XLogP | 0.90 |
| TPSA | 201.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|