C17H16O5S3 — CID 136503436
(2,4-dihydroxyphenyl)-(2,4-dihydroxy-5-propan-2-ylbenzenecarbothioyl)sulfinylmethanethione (PubChem CID 136503436) has the molecular formula C17H16O5S3 and a molecular weight of 396.51 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)-(2,4-dihydroxy-5-propan-2-ylbenzenecarbothioyl)sulfinylmethanethione.
| Compound Name | (2,4-dihydroxyphenyl)-(2,4-dihydroxy-5-propan-2-ylbenzenecarbothioyl)sulfinylmethanethione |
|---|---|
| PubChem CID | 136503436 |
| Molecular Formula | C17H16O5S3 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | (2,4-dihydroxyphenyl)-(2,4-dihydroxy-5-propan-2-ylbenzenecarbothioyl)sulfinylmethanethione |
| SMILES | CC(C)c1cc(C(=S)S(=O)C(=S)c2ccc(O)cc2O)c(O)cc1O |
| InChI | InChI=1S/C17H16O5S3/c1-8(2)11-6-12(15(21)7-14(11)20)17(24)25(22)16(23)10-4-3-9(18)5-13(10)19/h3-8,18-21H,1-2H3 |
| InChIKey | NPBIMXGEIHAJCX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|