C18H14FN7O — CID 136511247
12-(4-fluorophenyl)-13-(1H-1,2,4-triazol-5-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one (PubChem CID 136511247) has the molecular formula C18H14FN7O and a molecular weight of 363.36 g/mol. Its IUPAC name is 12-(4-fluorophenyl)-13-(1H-1,2,4-triazol-5-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one.
| Compound Name | 12-(4-fluorophenyl)-13-(1H-1,2,4-triazol-5-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one |
|---|---|
| PubChem CID | 136511247 |
| Molecular Formula | C18H14FN7O |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 12-(4-fluorophenyl)-13-(1H-1,2,4-triazol-5-yl)-2,3,10,11-tetrazatricyclo[7.4.1.05,14]tetradeca-1,5(14),6,8-tetraen-4-one |
| SMILES | O=c1[nH]nc2c3c(cccc13)NNC(c1ccc(F)cc1)C2c1ncn[nH]1 |
| InChI | InChI=1S/C18H14FN7O/c19-10-6-4-9(5-7-10)15-14(17-20-8-21-25-17)16-13-11(18(27)26-24-16)2-1-3-12(13)22-23-15/h1-8,14-15,22-23H,(H,26,27)(H,20,21,25) |
| InChIKey | XPGZQCCGZASJBP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |