C20H29FN4O2 — CID 136531851
2-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoylamino]-2-(4-fluorophenyl)acetamide (PubChem CID 136531851) has the molecular formula C20H29FN4O2 and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoylamino]-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoylamino]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 136531851 |
| Molecular Formula | C20H29FN4O2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-[[1-(cyclopentylmethyl)piperidin-4-yl]carbamoylamino]-2-(4-fluorophenyl)acetamide |
| SMILES | NC(=O)C(NC(=O)NC1CCN(CC2CCCC2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H29FN4O2/c21-16-7-5-15(6-8-16)18(19(22)26)24-20(27)23-17-9-11-25(12-10-17)13-14-3-1-2-4-14/h5-8,14,17-18H,1-4,9-13H2,(H2,22,26)(H2,23,24,27) |
| InChIKey | UBHBROSLAHOQHQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |