About 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one
4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 136535620) has the molecular formula C22H32N2O2
and a molecular weight of 356.51 g/mol. Its IUPAC name is 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one.
Molecular Properties
| Compound Name | 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one |
| PubChem CID | 136535620 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | CC(O)(CNC1CCC2(CC1)C(=O)Nc1ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C22H32N2O2/c1-21(26,16-7-3-2-4-8-16)15-23-17-11-13-22(14-12-17)18-9-5-6-10-19(18)24-20(22)25/h5-6,9-10,16-17,23,26H,2-4,7-8,11-15H2,1H3,(H,24,25) |
| InChIKey | UTXAQUNXBZTUHD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one?
The IUPAC name of 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one (CID 136535620) is 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one.
What is the SMILES notation for 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one?
The canonical SMILES for 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one is CC(O)(CNC1CCC2(CC1)C(=O)Nc1ccccc12)C1CCCCC1.
What is the InChIKey of 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one?
The InChIKey is UTXAQUNXBZTUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N2O2/c1-21(26,16-7-3-2-4-8-16)15-23-17-11-13-22(14-12-17)18-9-5-6-10-19(18)24-20(22)25/h5-6,9-10,16-17,23,26H,2-4,7-8,11-15H2,1H3,(H,24,25).
What are the key properties of 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one?
4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one has a molecular weight of 356.51 g/mol, XLogP of 3.74, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-[(2-cyclohexyl-2-hydroxypropyl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one is sourced from PubChem (CID 136535620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).