C22H24N4O — CID 127761821
4'-[(1-ethylindazol-6-yl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one (PubChem CID 127761821) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 4'-[(1-ethylindazol-6-yl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one.
| Compound Name | 4'-[(1-ethylindazol-6-yl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 127761821 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4'-[(1-ethylindazol-6-yl)amino]spiro[1H-indole-3,1'-cyclohexane]-2-one |
| SMILES | CCn1ncc2ccc(NC3CCC4(CC3)C(=O)Nc3ccccc34)cc21 |
| InChI | InChI=1S/C22H24N4O/c1-2-26-20-13-17(8-7-15(20)14-23-26)24-16-9-11-22(12-10-16)18-5-3-4-6-19(18)25-21(22)27/h3-8,13-14,16,24H,2,9-12H2,1H3,(H,25,27) |
| InChIKey | KHYBTNRFBZXEIC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |