C20H26N4O2 — CID 142322594
N-(1-aminoethylidene)-2-[[(2-oxospiro[1H-indole-3,4'-cyclohexane]-1'-yl)amino]methyl]cyclopropane-1-carboxamide (PubChem CID 142322594) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-(1-aminoethylidene)-2-[[(2-oxospiro[1H-indole-3,4'-cyclohexane]-1'-yl)amino]methyl]cyclopropane-1-carboxamide.
| Compound Name | N-(1-aminoethylidene)-2-[[(2-oxospiro[1H-indole-3,4'-cyclohexane]-1'-yl)amino]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142322594 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | N-(1-aminoethylidene)-2-[[(2-oxospiro[1H-indole-3,4'-cyclohexane]-1'-yl)amino]methyl]cyclopropane-1-carboxamide |
| SMILES | C/C(N)=N\C(=O)C1CC1CNC1CCC2(CC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C20H26N4O2/c1-12(21)23-18(25)15-10-13(15)11-22-14-6-8-20(9-7-14)16-4-2-3-5-17(16)24-19(20)26/h2-5,13-15,22H,6-11H2,1H3,(H,24,26)(H2,21,23,25) |
| InChIKey | STCCAVJMCYFHBF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|