C23H28N4O3 — CID 168758765
N-cyclohexyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2,2-dimethyl-3-oxopropanamide (PubChem CID 168758765) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-cyclohexyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2,2-dimethyl-3-oxopropanamide.
| Compound Name | N-cyclohexyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 168758765 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-cyclohexyl-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2,2-dimethyl-3-oxopropanamide |
| SMILES | [C-]#[N+][C@@H]1C[C@@]2(CN1C(=O)C(C)(C)C(=O)NC1CCCCC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C23H28N4O3/c1-22(2,19(28)25-15-9-5-4-6-10-15)21(30)27-14-23(13-18(27)24-3)16-11-7-8-12-17(16)26-20(23)29/h7-8,11-12,15,18H,4-6,9-10,13-14H2,1-2H3,(H,25,28)(H,26,29)/t18-,23-/m0/s1 |
| InChIKey | PPBHQYMPTGWDII-MBSDFSHPSA-N |
| XLogP | 2.83 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|