C25H32N4O4 — CID 164775219
N-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxohexan-2-yl]-3,3-dimethyl-2-oxo-N-(trideuteriomethyl)butanamide (PubChem CID 164775219) has the molecular formula C25H32N4O4 and a molecular weight of 455.57 g/mol. Its IUPAC name is N-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxohexan-2-yl]-3,3-dimethyl-2-oxo-N-(trideuteriomethyl)butanamide.
| Compound Name | N-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxohexan-2-yl]-3,3-dimethyl-2-oxo-N-(trideuteriomethyl)butanamide |
|---|---|
| PubChem CID | 164775219 |
| Molecular Formula | C25H32N4O4 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | N-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-1-oxohexan-2-yl]-3,3-dimethyl-2-oxo-N-(trideuteriomethyl)butanamide |
| SMILES | [2H]C([2H])([2H])N(C(=O)C(=O)C(C)(C)C)[C@@H](CCCC)C(=O)N1C[C@]2(C[C@H]1[N+]#[C-])C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C25H32N4O4/c1-7-8-13-18(28(6)22(32)20(30)24(2,3)4)21(31)29-15-25(14-19(29)26-5)16-11-9-10-12-17(16)27-23(25)33/h9-12,18-19H,7-8,13-15H2,1-4,6H3,(H,27,33)/t18-,19-,25-/m0/s1/i6D3 |
| InChIKey | PUMWTPQINLQQTM-OENDODCZSA-N |
| XLogP | 2.99 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|