C22H18F2N4O3 — CID 168758717
N-(3,5-difluorophenyl)-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-3-oxopropanamide (PubChem CID 168758717) has the molecular formula C22H18F2N4O3 and a molecular weight of 424.41 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-3-oxopropanamide.
| Compound Name | N-(3,5-difluorophenyl)-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-3-oxopropanamide |
|---|---|
| PubChem CID | 168758717 |
| Molecular Formula | C22H18F2N4O3 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-2-methyl-3-oxopropanamide |
| SMILES | [C-]#[N+][C@@H]1C[C@@]2(CN1C(=O)C(C)C(=O)Nc1cc(F)cc(F)c1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C22H18F2N4O3/c1-12(19(29)26-15-8-13(23)7-14(24)9-15)20(30)28-11-22(10-18(28)25-2)16-5-3-4-6-17(16)27-21(22)31/h3-9,12,18H,10-11H2,1H3,(H,26,29)(H,27,31)/t12?,18-,22-/m0/s1 |
| InChIKey | ZBKIAYFXOPLINH-KZHCXKQISA-N |
| XLogP | 2.91 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|