C27H27N5O3 — CID 168758733
N-(1H-indol-2-yl)-2-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-4-methylpentanamide (PubChem CID 168758733) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-(1H-indol-2-yl)-2-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-4-methylpentanamide.
| Compound Name | N-(1H-indol-2-yl)-2-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 168758733 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-(1H-indol-2-yl)-2-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-carbonyl]-4-methylpentanamide |
| SMILES | [C-]#[N+][C@@H]1C[C@@]2(CN1C(=O)C(CC(C)C)C(=O)Nc1cc3ccccc3[nH]1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C27H27N5O3/c1-16(2)12-18(24(33)31-22-13-17-8-4-6-10-20(17)29-22)25(34)32-15-27(14-23(32)28-3)19-9-5-7-11-21(19)30-26(27)35/h4-11,13,16,18,23,29H,12,14-15H2,1-2H3,(H,30,35)(H,31,33)/t18?,23-,27-/m0/s1 |
| InChIKey | GLPDRHXQALCQHV-PSRIYKRRSA-N |
| XLogP | 4.14 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|