C29H30F3N5O4 — CID 164775201
N'-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 164775201) has the molecular formula C29H30F3N5O4 and a molecular weight of 569.58 g/mol. Its IUPAC name is N'-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N'-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 164775201 |
| Molecular Formula | C29H30F3N5O4 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | N'-[(2S)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-4,4-dimethyl-1-oxopentan-2-yl]-N-phenyl-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | [C-]#[N+][C@@H]1C[C@@]2(CN1C(=O)[C@H](CC(C)(C)C)N(CC(F)(F)F)C(=O)C(=O)Nc1ccccc1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H30F3N5O4/c1-27(2,3)14-21(36(17-29(30,31)32)25(40)23(38)34-18-10-6-5-7-11-18)24(39)37-16-28(15-22(37)33-4)19-12-8-9-13-20(19)35-26(28)41/h5-13,21-22H,14-17H2,1-3H3,(H,34,38)(H,35,41)/t21-,22-,28-/m0/s1 |
| InChIKey | NLRQZSUMPWRJMN-VPYPWEPUSA-N |
| XLogP | 4.19 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|