C28H38N4O3 — CID 164959220
(2R,5S)-6-cyclopropyl-5-(dimethylamino)-2-(2,2-dimethylpropyl)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]hexane-1,4-dione (PubChem CID 164959220) has the molecular formula C28H38N4O3 and a molecular weight of 478.64 g/mol. Its IUPAC name is (2R,5S)-6-cyclopropyl-5-(dimethylamino)-2-(2,2-dimethylpropyl)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]hexane-1,4-dione.
| Compound Name | (2R,5S)-6-cyclopropyl-5-(dimethylamino)-2-(2,2-dimethylpropyl)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]hexane-1,4-dione |
|---|---|
| PubChem CID | 164959220 |
| Molecular Formula | C28H38N4O3 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (2R,5S)-6-cyclopropyl-5-(dimethylamino)-2-(2,2-dimethylpropyl)-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]hexane-1,4-dione |
| SMILES | [C-]#[N+][C@@H]1C[C@@]2(CN1C(=O)[C@@H](CC(=O)[C@H](CC1CC1)N(C)C)CC(C)(C)C)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H38N4O3/c1-27(2,3)15-19(14-23(33)22(31(5)6)13-18-11-12-18)25(34)32-17-28(16-24(32)29-4)20-9-7-8-10-21(20)30-26(28)35/h7-10,18-19,22,24H,11-17H2,1-3,5-6H3,(H,30,35)/t19-,22-,24-,28-/m0/s1 |
| InChIKey | BPDJDSYGGFYOFN-AAIXPWDYSA-N |
| XLogP | 4.10 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|