C28H23N3O3 — CID 168758709
(2R)-2-benzyl-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-phenylpropane-1,3-dione (PubChem CID 168758709) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2R)-2-benzyl-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-phenylpropane-1,3-dione.
| Compound Name | (2R)-2-benzyl-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 168758709 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (2R)-2-benzyl-1-[(2'R,3R)-2'-isocyano-2-oxospiro[1H-indole-3,4'-pyrrolidine]-1'-yl]-3-phenylpropane-1,3-dione |
| SMILES | [C-]#[N+][C@@H]1C[C@@]2(CN1C(=O)C(Cc1ccccc1)C(=O)c1ccccc1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H23N3O3/c1-29-24-17-28(22-14-8-9-15-23(22)30-27(28)34)18-31(24)26(33)21(16-19-10-4-2-5-11-19)25(32)20-12-6-3-7-13-20/h2-15,21,24H,16-18H2,(H,30,34)/t21?,24-,28-/m0/s1 |
| InChIKey | GQOQLMGMRPYNCG-SNHFLWDVSA-N |
| XLogP | 4.10 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|