C14H15ClFN3O2S — CID 136561171
5-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrazole (PubChem CID 136561171) has the molecular formula C14H15ClFN3O2S and a molecular weight of 343.81 g/mol. Its IUPAC name is 5-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrazole.
| Compound Name | 5-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrazole |
|---|---|
| PubChem CID | 136561171 |
| Molecular Formula | C14H15ClFN3O2S |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 5-[1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidin-2-yl]-1-methylpyrazole |
| SMILES | Cn1nccc1C1CCCN1S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C14H15ClFN3O2S/c1-18-12(6-7-17-18)13-3-2-8-19(13)22(20,21)14-9-10(16)4-5-11(14)15/h4-7,9,13H,2-3,8H2,1H3 |
| InChIKey | IUEYHZOOWCSTCD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |